A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1055 |
| PubChem ID | 68570 |
| Hormone name | Epiestradiol |
| Description | used for treating androgenetic alopecia |
| Synonyms | Epiestradiol Alfatradiol alfatradiol alpha-Estradiol Estradiol 17alpha-Estradiol Estradiol-17alpha .alpha.-Estradiol |
| Molecular weight | 272.38 |
| Molecular formula | C18H24O2 |
| IUPAC Name | (8R,9S,13S,14S,17R)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| Canonical smiles | CC12CCC3C(C1CCC2O)CCC4=C3C=CC(=C4)O |
| Isomeric smiles | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@H]2O)CCC4=C3C=CC(=C4)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C02537 D07121 |
| HMDB ID | HMDB00429 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | HMDB |