A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1050 |
| PubChem ID | 9305 |
| Hormone name | Diiodotyrosine |
| Description | A product from the iodination of MONOIODOTYROSINE. In the biosynthesis of thyroid hormones, diiodotyrosine residues are coupled with other monoiodotyrosine or diiodotyrosine residues to form T4 or T3 thyroid hormones (THYROXINE and TRIIODOTHYRONINE). |
| Synonyms | L-Diiodotyrosine 3,5-Diiodo-L-tyrosine DIT (amino acid) L-3,5-Diiodotyrosine 3,5-L-Diiodotyrosine 3,5-Iodo-L-tyrosine 3,5-DIIODOTYROSINE L-Tyrosine, 3,5-diiodo- |
| Molecular weight | 432.98 |
| Molecular formula | C9H9I2NO3 |
| IUPAC Name | (2S)-2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid |
| Canonical smiles | C1=C(C=C(C(=C1I)O)I)CC(C(=O)O)N |
| Isomeric smiles | C1=C(C=C(C(=C1I)O)I)C[C@@H](C(=O)O)N
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C01060Â |
| HMDB ID | HMDB03474 |
| Melting Point | N/A |
| Log P | 0.57(EST) |
| Water Solubility | 617(EXP) at 25C |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | Pubchem |