A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1049 |
| PubChem ID | 37123 |
| Hormone name | Diflubenzuron |
| Description | An insect growth regulator which interferes with the formation of the insect cuticle. It is effective in the control of mosquitoes and flies. |
| Synonyms | Difluron Diflubenzuron Dimilin Duphacid Larvakil Micromite Astonex Dimilin G1 Dimilin G4 |
| Molecular weight | 310.68 |
| Molecular formula | C14H9ClF2N2O2 |
| IUPAC Name | N-[(4-chlorophenyl)carbamoyl]-2,6-difluorobenzamide |
| Canonical smiles | C1=CC(=C(C(=C1)F)C(=O)NC(=O)NC2=CC=C(C=C2)Cl)F |
| Isomeric smiles | N/A
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C14427 D07829 |
| HMDB ID | N/A |
| Melting Point | 239(EXP) |
| Log P | 3.88(EXP) |
| Water Solubility | 0.08(EXP) at 25C |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | Pubchem |