A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1047 |
| PubChem ID | 71414 |
| Hormone name | Diflorasone diacetate |
| Description | RN given refers to (6alpha,11beta,16beta)-isomer; structure |
| Synonyms | Florone diflorasone diacetate Psorcon Maxiflor diflorasone diacetate diflorasone Apexicon e Psorcon (TN) Diflorasone di(acetate) |
| Molecular weight | 494.52 |
| Molecular formula | C26H32F2O7 |
| IUPAC Name | [(6S,8S,9R,10S,11S,13S,14S,16S,17R)-17-(2-acetyloxyacetyl)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phen anthren-17-yl] acetate |
| Canonical smiles | CC1CC2C3CC(C4=CC(=O)C=CC4(C3(C(CC2(C1(C(=O)COC(=O)C)OC(=O)C)C)O)F)C)F |
| Isomeric smiles | C[C@H]1C[C@H]2[C@@H]3C[C@@H](C4=CC(=O)C=C[C@@]4([C@]3([C@H](C[C@@]2([C@]1(C(=O)COC(=O)C)OC(=O)C)C)O)F)C)F
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | D01327 |
| HMDB ID | N/A |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | DB00223 |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | Pubchem |