A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1040 |
| PubChem ID | 5952 |
| Hormone name | Desoxycorticosterone acetate |
| Description | 21-Hydroxypregn-4-ene-3,20-dione. Desoxycorticosterone acetate (DOCA) is used as replacement therapy in ADDISON DISEASE. |
| Synonyms | Percotol Descorterone Desoxycortonum Desoxykorton Decosteron Decostrate Docaquosum Dorcostrin Krinocorts |
| Molecular weight | 372.5 |
| Molecular formula | C23H32O4 |
| IUPAC Name | [2-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
| Canonical smiles | CC(=O)OCC(=O)C1CCC2C1(CCC3C2CCC4=CC(=O)CCC34C)C |
| Isomeric smiles | CC(=O)OCC(=O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)C
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C14554 D03698 |
| HMDB ID | N/A |
| Melting Point | 157(EXP) |
| Log P | 3.08(EXP) |
| Water Solubility | 8.73(EXP) at 25C |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | Pubchem |