A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1014 |
| PubChem ID | 441301 |
| Hormone name | Androstane-3,17-diol |
| Description | The unspecified form of the steroid, normally a major metabolite of TESTOSTERONE with androgenic activity. It has been implicated as a regulator of gonadotropin secretion. |
| Synonyms | Androstanediol ANDROSTANE-3,17-DIOL |
| Molecular weight | 292.46 |
| Molecular formula | C19H32O2 |
| IUPAC Name | (3R,5S,8R,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol |
| Canonical smiles | CC12CCC(CC1CCC3C2CCC4(C3CCC4O)C)O |
| Isomeric smiles | C[C@]12CC[C@H](C[C@@H]1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CCC4O)C)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C07632 |
| HMDB ID | HMDB00495 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | Pubchem,HMDB |