A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1012 |
| PubChem ID | 32327 |
| Hormone name | Algestone Acetophenide |
| Description | A progesterone that has been used in ESTRUS SYNCHRONIZATION and has been evaluated as an injectable contraceptive in combination with estradiol enanthate. It is also used therapeutically as a topical anti-inflammatory and is applied topically in the treatment of ACNE. |
| Synonyms | Deladroxone Bovitrol Neolutin Droxone Algeston acetofenid P-Dhp Alphasone acetophenide |
| Molecular weight | 448.59 |
| Molecular formula | C29H36O4 |
| IUPAC Name | N/A |
| Canonical smiles | CC(=O)C12C(CC3C1(CCC4C3CCC5=CC(=O)CCC45C)C)OC(O2)(C)C6=CC=CC=C6 |
| Isomeric smiles | CC(=O)[C@@]12[C@@H](C[C@@H]3C1(CC[C@H]4C3CCC5=CC(=O)CCC45C)C)OC(O2)(C)C6=CC=CC=C6
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | N/A |
| HMDB ID | N/A |
| Melting Point | 150.5(EXP) |
| Log P | 5.53(EST) |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | Pubchem |