A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1008 |
| PubChem ID | 8956 |
| Hormone name | 20-alpha-Dihydroprogesterone |
| Description | A biologically active 20-alpha-reduced metabolite of PROGESTERONE. It is converted from progesterone to 20-alpha-hydroxypregn-4-en-3-one by the 20-ALPHA-HYDROXYSTEROID DEHYDROGENASE in the CORPUS LUTEUM and the PLACENTA. |
| Synonyms | Dihydrogesterone 20alpha-Progerol Progesterol-20-alpha 20-alpha-Dihydroprogesterone 20(S)-Hydroxyprogesterone 20alpha-Dihydroprognenolone 20-alpha-Hydroxyprogesterone |
| Molecular weight | 316.48 |
| Molecular formula | C21H32O2 |
| IUPAC Name | (8S,9S,10R,13S,14S,17S)-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| Canonical smiles | CC(C1CCC2C1(CCC3C2CCC4=CC(=O)CCC34C)C)O |
| Isomeric smiles | C[C@@H]([C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)C)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | 1MRQ   |
| KEGG ID | C04042 |
| HMDB ID | HMDB03069 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | Pubchem,HMDB |