![]() |
|
|
|
|
|
|
HMRbase accession number | 1365 |
PubChem ID | 5280723 |
Hormone name | Prostaglandin E1 |
Description | prostaglandin oligomeric derivative; RN given refers to cpd with unknown MF; inhibits several lipolytic and proteolytic enzymes |
Synonyms | alprostadil Prostaglandin E1 Befar Prostandin Prostavasin Caverject Topiglan Femprox Sugiran Viridal |
Molecular weight | 354.48 |
Molecular formula | C20H34O5 |
IUPAC Name | 7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoic acid |
Canonical smiles | CCCCCC(C=CC1C(CC(=O)C1CCCCCCC(=O)O)O)O |
Isomeric smiles | CCCCC[C@@H](C=C[C@H]1[C@@H](CC(=O)[C@@H]1CCCCCCC(=O)O)O)O
|
Structure | |
PDB file | |
SDF file | |
MOL file | |
PDB ID | N/A |
KEGG ID | C04741 D00180   |
HMDB ID | N/A |
Melting Point | N/A |
Log P | N/A |
Water Solubility | N/A |
DrugBank ID | DB00770 |
Drugpedia | wiki |
Receptor | P34995 Detail in HMRbase P43116 Detail in HMRbase P43115 Detail in HMRbase P35408 Detail in HMRbase P43119 Detail in HMRbase |
Comments | |
References | Endonet |