A database of hormones and their receptors |
|
|
|
|
|
|
HMRbase accession number | 1341 |
PubChem ID | 28204 |
Hormone name | Calusterone |
Description | was MH 1975-92 (see under METHYLTESTOSTERONE 1975-90); use METHYLTESTOSTERONE to search CALUSTERONE 1975-92; RN given refers to the (7beta,17beta)-isomer |
Synonyms | Methosarb CALUSTERONE Dimethyltestosterone Calusteron Calusteronum Calusterona 7beta,17-Dimethyltestosterone 7-beta,17-Dimethyltestosterone |
Molecular weight | 316.48 |
Molecular formula | C21H32O2 |
IUPAC Name | (7S,8R,9S,10R,13S,14S,17S)-17-hydroxy-7,10,13,17-tetramethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
Canonical smiles | CC1CC2=CC(=O)CCC2(C3C1C4CCC(C4(CC3)C)(C)O)C |
Isomeric smiles | C[C@H]1CC2=CC(=O)CC[C@@]2([C@@H]3[C@@H]1[C@@H]4CC[C@]([C@]4(CC3)C)(C)O)C
|
Structure | |
PDB file | |
SDF file | |
MOL file | |
PDB ID | N/A |
KEGG ID | D03338   |
HMDB ID | HMDB04627 |
Melting Point | N/A |
Log P | N/A |
Water Solubility | N/A |
DrugBank ID | N/A |
Drugpedia | wiki |
Receptor | N/A |
Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
References | HMDB |