A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1272 |
| PubChem ID | 92746 |
| Hormone name | zymosterol |
| Description | a 4,14-desmethyl intermediate between LANOSTEROL and CHOLESTEROL |
| Synonyms | Zymosterol zymostrol 5alpha-Cholesta-8,24-dien-3beta-ol delta8,24-Cholestadien-3beta-ol 5-alpha-Cholesta-8,24-dien-3-beta-ol |
| Molecular weight | 384.64 |
| Molecular formula | C27H44O |
| IUPAC Name | (3S,5S,10S,13R,14R,17R)-10,13-dimethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,4,5,6,7,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| Canonical smiles | CC(CCC=C(C)C)C1CCC2C1(CCC3=C2CCC4C3(CCC(C4)O)C)C |
| Isomeric smiles | C[C@H](CCC=C(C)C)[C@H]1CC[C@@H]2[C@@]1(CCC3=C2CC[C@@H]4[C@@]3(CC[C@@H](C4)O)C)C
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C05437 |
| HMDB ID | HMDB06271 |
| Melting Point | 8.65(EST) |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | HMDB |