A database of hormones and their receptors |
|
|
|
|
|
|
HMRbase accession number | 1269 |
PubChem ID | 10214816 |
Hormone name | 4-Dihydroboldenone |
Description | |
Synonyms | N/A |
Molecular weight | 288.42 |
Molecular formula | C19H28O2 |
IUPAC Name | (6S,9S,10R,13S,14S,17S)-17-hydroxy-6,13-dimethyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
Canonical smiles | CC1CC2C(CCC3(C2CCC3O)C)C4C1=CC(=O)CC4 |
Isomeric smiles | C[C@H]1CC2[C@H](CC[C@]3([C@H]2CC[C@@H]3O)C)[C@@H]4C1=CC(=O)CC4
|
Structure | |
PDB file | |
SDF file | |
MOL file | |
PDB ID | N/A |
KEGG ID | N/A |
HMDB ID | HMDB06035 |
Melting Point | N/A |
Log P | N/A |
Water Solubility | N/A |
DrugBank ID | N/A |
Drugpedia | wiki |
Receptor | N/A |
Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
References | HMDB |