![]() |
|
|
|
|
|
|
HMRbase accession number | 1230 |
PubChem ID | 5202 |
Hormone name | Serotonin |
Description | A biochemical messenger and regulator, synthesized from the essential amino acid L-TRYPTOPHAN. In humans it is found primarily in the central nervous system, gastrointestinal tract, and blood platelets. Serotonin mediates several important physiological functions including neurotransmission, gastrointestinal motility, hemostasis, and cardiovascular integrity. Multiple receptor families (RECEPTORS, SEROTONIN) explain the broad physiological actions and distribution of this biochemical mediator. |
Synonyms | Serotonin Enteramine Serotonine Thrombocytin Thrombotonin Antemoqua Antemovis Hippophain |
Molecular weight | 176.22 |
Molecular formula | C10H12N2O |
IUPAC Name | 3-(2-aminoethyl)-1H-indol-5-ol |
Canonical smiles | C1=CC2=C(C=C1O)C(=CN2)CCN |
Isomeric smiles | N/A
|
Structure | |
PDB file | |
SDF file | |
MOL file | |
PDB ID | 2QEH 3BRN |
KEGG ID | C00780 |
HMDB ID | HMDB00259 |
Melting Point | 167.5(EXP) |
Log P | 0.21(EXP) |
Water Solubility | 2.00E+04(EXP) |
DrugBank ID | N/A |
Drugpedia | wiki |
Receptor | P47898 Detail in HMRbase Q13639 Detail in HMRbase P28335 Detail in HMRbase P28223 Detail in HMRbase P46098 Detail in HMRbase P18089 Detail in HMRbase P08913 Detail in HMRbase |
Comments | |
References | Endonet |