A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1222 |
| PubChem ID | 440623 |
| Hormone name | 2-hydroxyestrone |
| Description | catechol estrogen which is a major metabolite of estradiol in man and animals; RN given refers to parent cpd |
| Synonyms | Catecholestrone 2-hydroxyestrone 2,3-Dihydroxyestra-1,3,5(10)-trien-17-one 2,3-dihydroxy-estra-1,3,5(10)-trien-17-one Estra-1,3,5(10)-trien-17-one, 2,3-dihydroxy- |
| Molecular weight | 286.37 |
| Molecular formula | C18H22O3 |
| IUPAC Name | (8R,9S,13S,14S)-2,3-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| Canonical smiles | CC12CCC3C(C1CCC2=O)CCC4=CC(=C(C=C34)O)O |
| Isomeric smiles | C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CCC4=CC(=C(C=C34)O)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C05298 |
| HMDB ID | HMDB00343 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | HMDB |