A database of hormones and their receptors |
|
|
|
|
|
|
HMRbase accession number | 1181 |
PubChem ID | 10204 |
Hormone name | Epitestosterone |
Description | The 17-alpha isomer of TESTOSTERONE, derived from PREGNENOLONE via the delta5-steroid pathway, and via 5-androstene-3-beta,17-alpha-diol. Epitestosterone acts as an antiandrogen in various target tissues. The ratio between testosterone/epitestosterone is used to monitor anabolic drug abuse. |
Synonyms | Epitestosterone Isotestosterone cis-Testosterone 17-Epitestosterone 17-alpha-Testosterone Testosterone, cis- alpha epitestosterone 17 alpha Testosterone |
Molecular weight | 288.42 |
Molecular formula | C19H28O2 |
IUPAC Name | (8R,9S,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
Canonical smiles | CC12CCC3C(C1CCC2O)CCC4=CC(=O)CCC34C |
Isomeric smiles | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@H]2O)CCC4=CC(=O)CC[C@]34C
|
Structure | |
PDB file | |
SDF file | |
MOL file | |
PDB ID | 2IPF  2IPG  2IPJ   |
KEGG ID | N/A |
HMDB ID | HMDB00628 |
Melting Point | N/A |
Log P | N/A |
Water Solubility | N/A |
DrugBank ID | N/A |
Drugpedia | wiki |
Receptor | N/A |
Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
References | Pubchem,HMDB |