A database of hormones and their receptors |
|
|
|
|
|
|
HMRbase accession number | 1164 |
PubChem ID | 3269 |
Hormone name | Epiestriol |
Description | A hydroxylated metabolite of ESTRADIOL or ESTRONE that has a hydroxyl group at C3-beta, 16-alpha, and 17-beta position. Estriol is a major urinary estrogen. During PREGNANCY, large amount of estriol is produced by the PLACENTA. Isomers with inversion of the hydroxyl group or groups are called epiestriol. |
Synonyms | Epiestriol Estriol 16-Epiestriol |
Molecular weight | 288.38 |
Molecular formula | C18H24O3 |
IUPAC Name | 13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-triol |
Canonical smiles | CC12CCC3C(C1CC(C2O)O)CCC4=C3C=CC(=C4)O |
Isomeric smiles | N/A
|
Structure | |
PDB file | |
SDF file | |
MOL file | |
PDB ID | N/A |
KEGG ID | N/A |
HMDB ID | HMDB00347 |
Melting Point | N/A |
Log P | N/A |
Water Solubility | N/A |
DrugBank ID | N/A |
Drugpedia | wiki |
Receptor | N/A |
Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
References | Pubchem,HMDB |