A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1135 |
| PubChem ID | 247732 |
| Hormone name | Epietiocholanolone |
| Description | |
| Synonyms | Epietiocholanolone 3.beta.-Etiocholanolone 5.beta.-Epiandrosterone epi-5.beta.-androsterone Etiocholan-3.beta.-ol-17-one 3.beta.-Hydroxyetiocholan-17-one 3.beta.-Hydroxy-5.beta.-androstane-17-one 5.beta.-Androstan-17-one, 3.beta.-hydroxy- Androstan-17-one, 3-hydroxy-, (3.beta.,5.beta.)- |
| Molecular weight | 290.44 |
| Molecular formula | C19H30O2 |
| IUPAC Name | (3S,5R,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
| Canonical smiles | CC12CCC(CC1CCC3C2CCC4(C3CCC4=O)C)O |
| Isomeric smiles | C[C@]12CC[C@@H](C[C@H]1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CCC4=O)C)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | N/A |
| HMDB ID | HMDB00546 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | HMDB |