A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1121 |
| PubChem ID | 5864 |
| Hormone name | Urocortisol |
| Description | |
| Synonyms | Urocortisol Tetrahydro F Tetrahydrocompound F Tetrahydrohydrocortisone Cortisol, tetrahydro- 5beta-Tetrahydrocortisol TETRAHYDROCORTISOL 5-beta-Tetrahydrocortisol 3alpha,5beta-Tetrahydrocortisol 5.beta.-Tetrahydrocortisol |
| Molecular weight | 366.49 |
| Molecular formula | C21H34O5 |
| IUPAC Name | 2-hydroxy-1-[(3R,5R,8S,9S,10S,11S,13S,14S,17R)-3,11,17-trihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17 -yl]ethanone |
| Canonical smiles | CC12CCC(CC1CCC3C2C(CC4(C3CCC4(C(=O)CO)O)C)O)O |
| Isomeric smiles | C[C@]12CC[C@H](C[C@H]1CC[C@@H]3[C@@H]2[C@H](C[C@]4([C@H]3CC[C@@]4(C(=O)CO)O)C)O)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C05472 |
| HMDB ID | HMDB00949 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | Pubchem,HMDB |