A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1116 |
| PubChem ID | 5819 |
| Hormone name | L-thyroxine |
| Description | The major hormone derived from the thyroid gland. Thyroxine is synthesized via the iodination of tyrosines (MONOIODOTYROSINE) and the coupling of iodotyrosines (DIIODOTYROSINE) in the THYROGLOBULIN. Thyroxine is released from thyroglobulin by proteolysis and secreted into the blood. Thyroxine is peripherally deiodinated to form TRIIODOTHYRONINE which exerts a broad spectrum of stimulatory effects on cell metabolism. |
| Synonyms | L-thyroxine Thyroxine levothyroxine synthroid thyroxin Thyroxine iodine Levothyroxin Thyreoideum Thyratabs Thyroxinal |
| Molecular weight | 776.87 |
| Molecular formula | C15H11I4NO4 |
| IUPAC Name | (2S)-2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoicacid |
| Canonical smiles | C1=C(C=C(C(=C1I)OC2=CC(=C(C(=C2)I)O)I)I)CC(C(=O)O)N |
| Isomeric smiles | C1=C(C=C(C(=C1I)OC2=CC(=C(C(=C2)I)O)I)I)C[C@@H](C(=O)O)N
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | 1ICT 1IE4 1HK1 1HK2 1HK3 1HK4 1HK5 1SN0 1Y0X 2CEO 2ROX 2RIW 1ETA 1ETB |
| KEGG ID | C01829 |
| HMDB ID | HMDB00248 |
| Melting Point | 235.5(EXP) |
| Log P | 4.12(EST) |
| Water Solubility | 1.05E-04(EST) at 25C |
| DrugBank ID | DB00451 |
| Drugpedia | wiki |
| Receptor | P10828 Detail in HMRbase P10827 Detail in HMRbase |
| Comments | |
| References | Pubchem |