A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1108 |
| PubChem ID | 5994 |
| Hormone name | Progestrone |
| Description | The major progestational steroid that is secreted primarily by the CORPUS LUTEUM and the PLACENTA. Progesterone acts on the UTERUS, the MAMMARY GLANDS and the BRAIN. It is required in EMBRYO IMPLANTATION; PREGNANCY maintenance, and the development of mammary tissue for MILK production. Progesterone, converted from PREGNENOLONE, also serves as an intermediate in the biosynthesis of GONADAL STEROID HORMONES and adrenal CORTICOSTEROIDS. |
| Synonyms | Progesterone Crinone Luteohormone Progesteronum Syngesterone Prometrium Utrogestan Cyclogest Progestin Agolutin |
| Molecular weight | 314.46 |
| Molecular formula | C21H30O2 |
| IUPAC Name | (8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| Canonical smiles | CC(=O)C1CCC2C1(CCC3C2CCC4=CC(=O)CCC34C)C |
| Isomeric smiles | CC(=O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)C
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | 1W0F 1YA3 2AA5 2AA6 2ABA 2HZQ 2O5Y 1DBB 1A28 |
| KEGG ID | C00410 D00066 |
| HMDB ID | HMDB01830 |
| Melting Point | 121(EXP) |
| Log P | 3.87(EXP) |
| Water Solubility | 8.81(EXP) at 25C |
| DrugBank ID | DB00396 |
| Drugpedia | wiki |
| Receptor | P03372 Detail in HMRbase P06401 Detail in HMRbase |
| Comments | |
| References | Pubchem,HMDB |