A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1090 |
| PubChem ID | 5366546 |
| Hormone name | Methoprene |
| Description | Juvenile hormone analog and insect growth regulator used to control insects by disrupting metamorphosis. Has been effective in controlling mosquito larvae. |
| Synonyms | Methoprene Juvemon Pharoid Yuvemon Diacon Dianex Precor Kabat Manta Minex |
| Molecular weight | 310.47 |
| Molecular formula | C19H34O3 |
| IUPAC Name | propan-2-yl (2E,4E)-11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate |
| Canonical smiles | CC(C)OC(=O)C=C(C)C=CCC(C)CCCC(C)(C)OC |
| Isomeric smiles | CC(C)OC(=O)C=C(/C)C=CCC(C)CCCC(C)(C)OC
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C14308 |
| HMDB ID | N/A |
| Melting Point | < 25(EXP) |
| Log P | 5.5(EXP) |
| Water Solubility | 1.4(EXP) |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | Pubchem |