A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1088 |
| PubChem ID | 229021 |
| Hormone name | Methandriol |
| Description | A synthetic steroid with anabolic and androgenic properties. (From Martindale, The Extra Pharmacopoeia, 30th ed, p1188) |
| Synonyms | Methandriol Protandren Methandrioldiol Methylandrostenediol Crestabolic Diolandrone Diolostene Mestenediol Methanabol |
| Molecular weight | 304.47 |
| Molecular formula | C20H32O2 |
| IUPAC Name | (3S,8R,9S,10R,13S,14S,17S)-10,13,17-trimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-diol |
| Canonical smiles | CC12CCC(CC1=CCC3C2CCC4(C3CCC4(C)O)C)O |
| Isomeric smiles | C[C@]12CC[C@@H](CC1=CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CC[C@]4(C)O)C)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C14493 |
| HMDB ID | N/A |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | Pubchem |