![]() |
|
|
|
|
|
|
HMRbase accession number | 1082 |
PubChem ID | 5920 |
Hormone name | Triiodothyronine |
Description | A T3 thyroid hormone normally synthesized and secreted by the thyroid gland in much smaller quantities than thyroxine (T4). Most T3 is derived from peripheral monodeiodination of T4 at the 5' position of the outer ring of the iodothyronine nucleus. The hormone finally delivered and used by the tissues is mainly T3. |
Synonyms | liothyronine Triiodothyronine Liothyronin L-Liothyronine triothyrone Lyothyronine Tresitope Tri-Thyrotope T3 liothyronine Triiodo-L-thyronine |
Molecular weight | 650.97 |
Molecular formula | C15H12I3NO4 |
IUPAC Name | (2S)-2-amino-3-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]propanoicacid |
Canonical smiles | C1=CC(=C(C=C1OC2=C(C=C(C=C2I)CC(C(=O)O)N)I)I)O |
Isomeric smiles | C1=CC(=C(C=C1OC2=C(C=C(C=C2I)C[C@@H](C(=O)O)N)I)I)O
|
Structure | |
PDB file | |
SDF file | |
MOL file | |
PDB ID | 1BSX  1SN5  1XZX  2H6W  2H77  2H79  2PIV  2PIW   |
KEGG ID | C02465 |
HMDB ID | HMDB00265 |
Melting Point | 236.5(EXP) |
Log P | 2.96(EST) |
Water Solubility | 3.96(EXP) at 37C |
DrugBank ID | DB00279 |
Drugpedia | wiki |
Receptor | P10827 Detail in HMRbase P10828 Detail in HMRbase P37243 Detail in HMRbase |
Comments | |
References | Pubchem |