A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1067 |
| PubChem ID | 16490 |
| Hormone name | Flumethasone |
| Description | An anti-inflammatory glucocorticoid used in veterinary practice. |
| Synonyms | Flumethasone Flucorticin Flumethason Cortexilar Anaprime Aniprime Methagon Flucort Fluvet |
| Molecular weight | 410.45 |
| Molecular formula | C22H28F2O5 |
| IUPAC Name | (6S,8S,9R,10S,11S,13S,14S,16R,17R)-6,9-difluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanth ren-3-one |
| Canonical smiles | CC1CC2C3CC(C4=CC(=O)C=CC4(C3(C(CC2(C1(C(=O)CO)O)C)O)F)C)F |
| Isomeric smiles | C[C@@H]1C[C@H]2[C@@H]3C[C@@H](C4=CC(=O)C=C[C@@]4([C@]3([C@H](C[C@@]2([C@]1(C(=O)CO)O)C)O)F)C)F
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C14479 D04208 |
| HMDB ID | N/A |
| Melting Point | N/A |
| Log P | 1.94(EXP) |
| Water Solubility | 1(EXP) at 20C |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | Pubchem |