A database of hormones and their receptors |
|
|
|
|
|
|
HMRbase accession number | 1062 |
PubChem ID | 5756 |
Hormone name | Estriol |
Description | A hydroxylated metabolite of ESTRADIOL or ESTRONE that has a hydroxyl group at C3-beta, 16-alpha, and 17-beta position. Estriol is a major urinary estrogen. During PREGNANCY, large amount of estriol is produced by the PLACENTA. Isomers with inversion of the hydroxyl group or groups are called epiestriol. |
Synonyms | Estriol Oestriol Estratriol Tridestrin Ovestrion Trihydroxyestrin Aacifemine Oestratriol Oestriolum Destriol |
Molecular weight | 288.38 |
Molecular formula | C18H24O3 |
IUPAC Name | (8R,9S,13S,14S,16R,17R)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-triol |
Canonical smiles | CC12CCC3C(C1CC(C2O)O)CCC4=C3C=CC(=C4)O |
Isomeric smiles | C[C@]12CC[C@H]3[C@H]([C@@H]1C[C@H]([C@@H]2O)O)CCC4=C3C=CC(=C4)O
|
Structure | |
PDB file | |
SDF file | |
MOL file | |
PDB ID | 1X8V   |
KEGG ID | C05141 D00185   |
HMDB ID | HMDB00153 |
Melting Point | 282(EXP) |
Log P | 2.45(EXP) |
Water Solubility | 441(EST) at 25C |
DrugBank ID | DB04573 |
Drugpedia | wiki |
Receptor | P03372 Detail in HMRbase |
Comments | |
References | Pubchem,HMDB |