![]() |
|
|
|
|
|
|
HMRbase accession number | 1011 |
PubChem ID | 11687 |
Hormone name | Algestone |
Description | A synthetic progestational dihydroxy derivative of PROGESTERONE. Its acetonide possesses anti-inflammatory properties. |
Synonyms | Alphasone Algestone Dihydroxyprogesterone Algestonum Algestona 16alpha,17-Dihydroxypregn-4-ene-3,20-dione |
Molecular weight | 346.46 |
Molecular formula | C21H30O4 |
IUPAC Name | (8R,9S,10R,13S,14S,16R,17S)-17-acetyl-16,17-dihydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
Canonical smiles | CC(=O)C1(C(CC2C1(CCC3C2CCC4=CC(=O)CCC34C)C)O)O |
Isomeric smiles | CC(=O)[C@]1([C@@H](C[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)C)O)O
|
Structure | |
PDB file | |
SDF file | |
MOL file | |
PDB ID | N/A |
KEGG ID | C06391 |
HMDB ID | N/A |
Melting Point | 225(EXP) |
Log P | 3.15(EST) |
Water Solubility | N/A |
DrugBank ID | N/A |
Drugpedia | wiki |
Receptor | N/A |
Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
References | Pubchem |