A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1364 |
| PubChem ID | 448457 |
| Hormone name | Prostaglandin D2 |
| Description | The principal cyclooxygenase metabolite of arachidonic acid. It is released upon activation of mast cells and is also synthesized by alveolar macrophages. Among its many biological actions, the most important are its bronchoconstrictor, platelet-activating-factor-inhibitory, and cytotoxic effects. |
| Synonyms | prostaglandin D2 Prostaglandin D2 PGD2 Prostaglandin D2 11-Dehydroprostaglandin F2-alpha |
| Molecular weight | 352.47 |
| Molecular formula | C20H32O5 |
| IUPAC Name | (Z)-7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]hept-5-enoic acid |
| Canonical smiles | CCCCCC(C=CC1C(C(CC1=O)O)CC=CCCCC(=O)O)O |
| Isomeric smiles | CCCCC[C@@H](C=C[C@@H]1[C@H]([C@H](CC1=O)O)CC=C/CCCC(=O)O)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | 1RY0 |
| KEGG ID | C00696 |
| HMDB ID | HMDB01403 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | DB02056 |
| Drugpedia | wiki |
| Receptor | Q13258 Detail in HMRbase |
| Comments | |
| References | Endonet |