A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1332 |
| PubChem ID | 439577 |
| Hormone name | Desmosterol |
| Description | An intermediate in the synthesis of cholesterol. |
| Synonyms | Desmosterol 24-Dehydrocholesterol Cholesta-5,24-dien-3beta-ol 5,24-Cholestadien-3beta-ol 5,24-cholestadien-3beta-ol cholest-5,24-dien-3beta-ol 3beta-cholesta-5,24-dien-3-ol 3beta-Hydroxy-5,24-cholestadiene |
| Molecular weight | 384.64 |
| Molecular formula | C27H44O |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| Canonical smiles | CC(CCC=C(C)C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C |
| Isomeric smiles | C[C@H](CCC=C(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C01802 |
| HMDB ID | HMDB02719 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | Q5BIS6 Detail in HMRbase P55055 Detail in HMRbase Q60644 Detail in HMRbase Q62755 Detail in HMRbase Q5E9B6 Detail in HMRbase Q13133 Detail in HMRbase Q9Z0Y9 Detail in HMRbase Q62685 Detail in HMRbase Q8AXU8 Detail in HMRbase Q8JHU1 Detail in HMRbase |
| Comments | !Link to Receptor is not Organism Specific |
| References | HMDB |