A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1322 |
| PubChem ID | 5283159 |
| Hormone name | 5-Oxoete |
| Description | RN given is for cpd without isomeric designation; an arachidonate metabolite which stimulates neutrophils to mobilize Ca and promotes PMN degranulation responses |
| Synonyms | 5-Oxoete 5-oxo-6,8,11,14-eicosatetraenoic acid 5-Oxo-ETE 5-Oxoicosatetraenoic acid |
| Molecular weight | 318.45 |
| Molecular formula | C20H30O3 |
| IUPAC Name | (6E,8Z,11Z,14Z)-5-oxoicosa-6,8,11,14-tetraenoic acid |
| Canonical smiles | CCCCCC=CCC=CCC=CC=CC(=O)CCCC(=O)O |
| Isomeric smiles | CCCCCC=C/CC=C/CC=C/C=C/C(=O)CCCC(=O)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C14732 |
| HMDB ID | N/A |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | Q8TDS5 Detail in HMRbase |
| Comments | |
| References | Endonet |