A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1071 |
| PubChem ID | 9878 |
| Hormone name | Fluorometholone |
| Description | A glucocorticoid employed, usually as eye drops, in the treatment of allergic and inflammatory conditions of the eye. It has also been used topically in the treatment of various skin disorders. (From Martindale, The Extra Pharmacopoeia, 30th ed, p732) |
| Synonyms | Fluorometholone Oxylone Flumetholon Cortilet Delmeson Trilcin FML Liquifilm Fluormetholonum |
| Molecular weight | 376.46 |
| Molecular formula | C22H29FO4 |
| IUPAC Name | (6S,8S,9R,10S,11S,13S,14S,17R)-17-acetyl-9-fluoro-11,17-dihydroxy-6,10,13-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
| Canonical smiles | CC1CC2C3CCC(C3(CC(C2(C4(C1=CC(=O)C=C4)C)F)O)C)(C(=O)C)O |
| Isomeric smiles | C[C@H]1C[C@H]2[C@@H]3CC[C@@]([C@]3(C[C@@H]([C@@]2([C@@]4(C1=CC(=O)C=C4)C)F)O)C)(C(=O)C)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | D01367 |
| HMDB ID | N/A |
| Melting Point | 297(EXP) |
| Log P | 2(EXP) |
| Water Solubility | 30(EXP) at 25C |
| DrugBank ID | DB00324 |
| Drugpedia | wiki |
| Receptor | P59667 Detail in HMRbase |
| Comments | |
| References | Pubchem |