A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1063 |
| PubChem ID | 5870 |
| Hormone name | Estrone |
| Description | An aromatized C18 steroid with a 3-hydroxyl group and a 17-ketone, a major mammalian estrogen. It is converted from ANDROSTENEDIONE directly, or from TESTOSTERONE via ESTRADIOL. In humans, it is produced primarily by the cyclic ovaries, PLACENTA, and the ADIPOSE TISSUE of men and postmenopausal women. |
| Synonyms | Estrone folliculin Theelin Cristallovar Crinovaryl Aquacrine Crystogen Destrone estrovarin Endofolliculina |
| Molecular weight | 270.37 |
| Molecular formula | C18H22O2 |
| IUPAC Name | (8R,9S,13S,14S)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| Canonical smiles | CC12CCC3C(C1CCC2=O)CCC4=C3C=CC(=C4)O |
| Isomeric smiles | C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CCC4=C3C=CC(=C4)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C00468 D00067 |
| HMDB ID | HMDB00145 |
| Melting Point | 260.2(EXP) |
| Log P | 3.13(EXP) |
| Water Solubility | 30(EXP) at 25C |
| DrugBank ID | DB00655 |
| Drugpedia | wiki |
| Receptor | P03372 Detail in HMRbase |
| Comments | |
| References | Pubchem |