A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1061 |
| PubChem ID | 5757 |
| Hormone name | Estradiol |
| Description | Generally refers to the 17-beta-isomer of estradiol, an aromatized C18 steroid with hydroxyl group at 3-beta- and 17-beta-position. Estradiol-17-beta is the most potent form of mammalian estrogenic steroids. In humans, it is produced primarily by the cyclic ovaries and the PLACENTA. It is also produced by the adipose tissue of men and postmenopausal women. The 17-alpha-isomer of estradiol binds weakly to estrogen receptors (RECEPTORS, ESTROGEN) and exhibits little estrogenic activity in estrogen-responsive tissues. Various isomers can be synthesized. |
| Synonyms | Estradiol beta-Estradiol 17beta-Estradiol Estrace progynon Dihydroxyestrin Oestradiol Diogynets Aquadiol Dihydrofolliculin |
| Molecular weight | 272.38 |
| Molecular formula | C18H24O2 |
| IUPAC Name | (8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| Canonical smiles | CC12CCC3C(C1CCC2O)CCC4=C3C=CC(=C4)O |
| Isomeric smiles | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)CCC4=C3C=CC(=C4)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | 1QKT 1QKU 1JGL 1G50 1JNN 1GWR 1LHU 1PCG 2D06 2J7X 1A52 1AQU 1IOL 1A27 1FDS 1FDT 1FDW 2OCF 1ERE |
| KEGG ID | C00951 D00105 |
| HMDB ID | HMDB00151 |
| Melting Point | 178.5(EXP) |
| Log P | 4.01(EXP) |
| Water Solubility | 3.6(EXP) at 27C |
| DrugBank ID | DB00783 |
| Drugpedia | wiki |
| Receptor | P03372 Detail in HMRbase Q92731 Detail in HMRbase O75469 Detail in HMRbase |
| Comments | |
| References | Pubchem |