Welcome to Sequence Card of Peptide
Details of SAPdb entry with Sequence VV |
| Primary information | |
|---|---|
| SAPdb ID | 1681, |
| PMID | 29890854 |
| Peptide Name | L-valine-valine |
| Peptide sequence | VV |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | peptide |
| Conjugate partner | None |
| Conc | 0.25 – 2% w/v |
| Year | 2018 |
| Self assembly | No |
| Type of Self assembly | NA |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| NA | |
| NA | |
| VV | |
| N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)O | |
| Primary information | |
| SAPdb ID | 1809, |
| PMID | 25564964 |
| Peptide Name | L-Val-L-Val-GCV (LLGCV) |
| Peptide sequence | VV |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | double-emulsion solvent evaporation technique |
| Solvent | thermosensitive PLGA-PEG-PLGA polymer gel |
| Method | Nanoparticles containing prodrugs of GCV were prepared by a double-emulsion solvent evaporation technique using various PLGA polymers with different drug/polymer ratios. |
| Conc | 23% w/w PLGA-PEG-PLGA aqueous solution |
| Temperature | Room temperature |
| Incubation Time | 48 hours |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Nanoparticles |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Other | |
| NA | |
| VV | |
| N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)O | |
| Primary information | |
| SAPdb ID | 1810, |
| PMID | 25564964 |
| Peptide Name | L-Val-D-Val-GCV (LDGCV) |
| Peptide sequence | VV |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | double-emulsion solvent evaporation technique |
| Solvent | thermosensitive PLGA-PEG-PLGA polymer gel |
| Method | Nanoparticles containing prodrugs of GCV were prepared by a double-emulsion solvent evaporation technique using various PLGA polymers with different drug/polymer ratios. |
| Conc | 23% w/w PLGA-PEG-PLGA aqueous solution |
| Temperature | Room temperature |
| Incubation Time | 48 hours |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Nanoparticles |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Other | |
| NA | |
| VV | |
| N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)O | |
| Primary information | |
| SAPdb ID | 1811, |
| PMID | 25564964 |
| Peptide Name | D-Val-L-Val-GCV (DLGCV) |
| Peptide sequence | VV |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | double-emulsion solvent evaporation technique |
| Solvent | thermosensitive PLGA-PEG-PLGA polymer gel |
| Method | Nanoparticles containing prodrugs of GCV were prepared by a double-emulsion solvent evaporation technique using various PLGA polymers with different drug/polymer ratios. |
| Conc | 23% w/w PLGA-PEG-PLGA aqueous solution |
| Temperature | Room temperature |
| Incubation Time | 48 hours |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Nanoparticles |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Other | |
| NA | |
| VV | |
| N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)O | |
| Primary information | |
| SAPdb ID | 1812, |
| PMID | 25775276 |
| Peptide Name | L-Val-L-Val-GCV (LLGCV) |
| Peptide sequence | VV |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | double emulsion method |
| Solvent | Poly(D,L-lactic-co-glycolic acid) (PLGA) |
| Conc | 2.0% (w/v) |
| Temperature | Room temperature |
| Incubation Time | 3h |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Nanoparticles |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Other | |
| 116 | |
| VV | |
| N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)O | |
| Primary information | |
| SAPdb ID | 1813, |
| PMID | 25775276 |
| Peptide Name | L-Val-D-Val-GCV (LDGCV) |
| Peptide sequence | VV |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | double emulsion method |
| Solvent | Poly(D,L-lactic-co-glycolic acid) (PLGA) |
| Conc | 2.0% (w/v) |
| Temperature | Room temperature |
| Incubation Time | 3h |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Nanoparticles |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Other | |
| 134 | |
| VV | |
| N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)O | |
| Primary information | |
| SAPdb ID | 1814, |
| PMID | 25775276 |
| Peptide Name | D-Val-L-Val-GCV (DLGCV) |
| Peptide sequence | VV |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | double emulsion method |
| Solvent | Poly(D,L-lactic-co-glycolic acid) (PLGA) |
| Conc | 2.0% (w/v) |
| Temperature | Room temperature |
| Incubation Time | 3h |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Nanoparticles |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Other | |
| 143 | |
| VV | |
| N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)O | |
| Primary information | |
| SAPdb ID | 1815, |
| PMID | 25775276 |
| Peptide Name | L-Val-L- Val-ACV (LLACV) |
| Peptide sequence | VV |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Scanning Electron Microscopy (SEM) |
| Year | 2015 |
| Self assembly | No |
| Type of Self assembly | NA |
| Tertiary Structure (Technique) | Not Predicted), |
| NA | |
| exhibited optimal properties in terms of enzymatic stability, uptake and cytotoxicity | |
| NA | |
| Other | |
| NA | |
| VV | |
| N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)O | |
| Primary information | |
| SAPdb ID | 1816, |
| PMID | 25775276 |
| Peptide Name | L-Val-D-Val-ACV (LDACV) |
| Peptide sequence | VV |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Scanning Electron Microscopy (SEM) |
| Year | 2015 |
| Self assembly | No |
| Type of Self assembly | NA |
| Tertiary Structure (Technique) | Not Predicted), |
| NA | |
| exhibited optimal properties in terms of enzymatic stability, uptake and cytotoxicity | |
| NA | |
| Other | |
| NA | |
| VV | |
| N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)O | |
| Primary information | |
| SAPdb ID | 1817, |
| PMID | 25775276 |
| Peptide Name | D-Val- L-Val-ACV (DLACV) |
| Peptide sequence | VV |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Scanning Electron Microscopy (SEM) |
| Year | 2015 |
| Self assembly | No |
| Type of Self assembly | NA |
| Tertiary Structure (Technique) | Not Predicted), |
| NA | |
| NA | |
| NA | |
| Other | |
| NA | |
| VV | |
| N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)O | |
| Primary information | |
| SAPdb ID | 1946, |
| PMID | 28589640 |
| Peptide Name | Boc-Val-Val-OMe |
| Peptide sequence | VV |
| N-Terminal Modification | Boc (or t-butoxycarbonyl) |
| C-Terminal Modification | Methoxy |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | SEM, circular dichroism, attenuated total internal reflection-fourier transform infrared spectroscopy, X-ray diffraction and microscopy |
| Solvent | organic solvents |
| Conc | 6 mM |
| Temperature | Room temperature |
| Incubation Time | 30 min |
| Year | 2017 |
| Self assembly | Yes |
| Type of Self assembly | annular protofibrillar structure |
| Tertiary Structure (Technique) | Not Predicted), |
| Cyclic | |
| NA | |
| NA | |
| Nanofiber | |
| 500 | |
| VV | |
| N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)O | |