Welcome to Entry Card of Peptide
Details of SAPdb ID 1816 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1816 | |
| PMID | 25775276 | |
| Year | 2015 | |
| Name | L-Val-D-Val-ACV (LDACV) | |
| Sequence | VV | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | None | |
| Technique | Scanning Electron Microscopy (SEM) | |
| Solvent | NA | |
| Method | NA | |
| Concentration | NA | |
| pH | NA | |
| Temperature | NA | |
| Incubation Period | NA | |
| Self-Assembly Formation | No | |
| Type of Self-Assembly | NA | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | NA | |
| Stability of Nanostructure | NA | |
| Comment | exhibited optimal properties in terms of enzymatic stability, uptake and cytotoxicity | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)O | |