Details of SAPdb ID 1810 |
Primary information | ||
---|---|---|
SAPdb_ID | 1810 | |
PMID | 25564964 | |
Year | 2015 | |
Name | L-Val-D-Val-GCV (LDGCV) | |
Sequence | VV | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 2 | |
Peptide/Conjugate/Mixture | Peptide | |
Conjugate Partner | None | |
Technique | double-emulsion solvent evaporation technique | |
Solvent | thermosensitive PLGA-PEG-PLGA polymer gel | |
Method | Nanoparticles containing prodrugs of GCV were prepared by a double-emulsion solvent evaporation technique using various PLGA polymers with different drug/polymer ratios. | |
Concentration | 23% w/w PLGA-PEG-PLGA aqueous solution | |
pH | NA | |
Temperature | Room temperature | |
Incubation Period | 48 hours | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Nanoparticles | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)O |