Details of SAPdb ID 1813 |
Primary information | ||
---|---|---|
SAPdb_ID | 1813 | |
PMID | 25775276 | |
Year | 2015 | |
Name | L-Val-D-Val-GCV (LDGCV) | |
Sequence | VV | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 2 | |
Peptide/Conjugate/Mixture | Peptide | |
Conjugate Partner | None | |
Technique | double emulsion method | |
Solvent | Poly(D,L-lactic-co-glycolic acid) (PLGA) | |
Method | NA | |
Concentration | 2.0% (w/v) | |
pH | NA | |
Temperature | Room temperature | |
Incubation Period | 3h | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Nanoparticles | |
Size of Self-Assembled structure | 134 nm | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)O |