| Primary information |
|---|
| SALID | SAL_16069 |
| Biomarker name | Dopamine-beta-Hydroxylase |
| Biomarker Type | NA |
| Sampling Method | Two normal control subjects and four psychiatric patients. |
| Collection Method | Patients and normal subjects were infused with I mc of tritiated dopamine (DA) (specific activity, 5.0 curie/ mmole) |
| Analysis Method | Radioimmunoassay |
| Collection Site | Whole Saliva |
| Disease Category | Psychiatric Disorder |
| Disease/Condition | Manic Depressive Psychosis |
| Disease Subtype | NA |
| Fold Change/ Concentration | NA |
| Up/Downregulated | Increase |
| Exosomal | NA |
| Organism | Homo sapiens |
| PMID | 4745595 |
| Year of Publication | 1973 |
| Biomarker ID | 135283644 |
| Biomarker Category | Metabolite |
| Sequence | CC1=C(C(=O)N(C2=NC(=NC=C12)Cl)C3CCCC3)I |
| Title of study | Dopamine-beta-hydroxylase: evidence for increased activity in sympathetic neurons during psychotic states |
| Abstract of study | Tritiated dopamine was infused into psychiatric patients during acute psychotic episodes and in remission. An index of the activity of dopamine-beta-hydroxylase of salivary gland sympathetic neurons was determined by measuring the distribution of tritiated metabolites in salivary fluid. Increased synthesis of norepinephrine occurred in acute schizophrenia and in the manic state of manic-depressive psychosis but not in the depressed phase. |