Welcome to Sequence Card of Peptide
Details of SAPdb entry with Sequence GSH |
| Primary information | |
|---|---|
| SAPdb ID | 1177, |
| PMID | 26354252 |
| Peptide Name | L-Glutathione |
| Peptide sequence | GSH |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Mixture |
| Conjugate partner | Gold substrates |
| Technique | AFM (Atomic Force Microscopy) |
| Solvent | Water + TW 20 |
| Method | Gold substrates were cleaned using freshly prepared piranha solution (3:7 (v/v) mixture of 30% H2O2 and H2SO4) for 30 min at room temperature rinsed copiously with deionized water (Millipore Gradient) and dried under a nitrogen stream. The two types of SAMs, GSH and GSHTW 20, were prepared by immersing the cleaned gold substrates into the freshly prepared 5 mM Glutathione aqueous solution and 5 mM Glutathione aqueous solution with 0.1% (v/v) TW 20, respectively. The substrate surfaceswere left for 24 h at room temperature, in the absence of light, than were taken out from the solutions, washed with ethanol and deionized water, dried under an argon gas flow and kept in a dessicator for further characterization. |
| Conc | 5mM |
| Temperature | Room temperature |
| Incubation Time | 24 hours |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Monolayer (On the surface of Gold (Au)) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| On the surface of Gold (Au) | |
| NA | |
| Other | |
| NA | |
| None | |
| NCC(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1nc[nH]c1)C=O | |
| Primary information | |
| SAPdb ID | 1672, |
| PMID | 29845161 |
| Peptide Name | Glutathione |
| Peptide sequence | GSH |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | tripeptide |
| Conjugate partner | None |
| Technique | Light microscope |
| Conc | 0.25 wt% |
| Year | 2018 |
| Self assembly | Yes |
| Type of Self assembly | nanoparticles |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Other | |
| 3-5 nm | |
| None | |
| NCC(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC1=CN=C-N1)C(=O)O | |
| Primary information | |
| SAPdb ID | 1684, |
| PMID | 29920571 |
| Peptide Name | HydropHilic interaction liquid chromatograpHy |
| Peptide sequence | GSH |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | tripeptide |
| Conjugate partner | None |
| Technique | SEM, TEM |
| Solvent | solvent A (water containing 0.1% formic acid) and solvent B (ACN containing 0.1% formic acid) |
| Conc | 1 mL of 50:50 (v:v) |
| Temperature | Room temperature |
| Incubation Time | 12 hours |
| Year | 2018 |
| Self assembly | Yes |
| Type of Self assembly | nanoparticles |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Other | |
| NA | |
| None | |
| NCC(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC1=CN=C-N1)C(=O)O | |
| Primary information | |
| SAPdb ID | 1688, |
| PMID | 29972201 |
| Peptide Name | Glutathione |
| Peptide sequence | GSH |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | tripeptide |
| Conjugate partner | None |
| Technique | High-resolution transmission electron microscopy (HR-TEM) |
| Solvent | aqueous soltuion of NaDC |
| Conc | 40 mM |
| Temperature | Room temperature |
| Incubation Time | 24 hours |
| Year | 2018 |
| Self assembly | Yes |
| Type of Self assembly | nanofibers |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanofiber | |
| NA | |
| GSH | |
| NCC(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC1=CN=C-N1)C(=O)O | |
| Primary information | |
| SAPdb ID | 1689, |
| PMID | 30021438 |
| Peptide Name | Glutathione |
| Peptide sequence | GSH |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | conjugated |
| Conjugate partner | TetrapHenylethylene (TPE) |
| Technique | Transmission Electron Microscopy (TEM) |
| Solvent | FMOC-Gly-Wang resin |
| Method | structure of γ-GSH, tripeptides were designed for the construction of Hg2+-responsive supermolecular assemblies |
| Conc | 50% ACN, 25% of 0.1% TFA, and 25% |
| Year | 2018 |
| Self assembly | Yes |
| Type of Self assembly | nanofibers |
| Tertiary Structure (Technique) | Not Predicted), |
| NA | |
| NA | |
| NA | |
| Nanofiber | |
| NA | |
| GSH | |
| NCC(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC1=CN=C-N1)C(=O)O | |
| Primary information | |
| SAPdb ID | 1749, |
| PMID | 30850145 |
| Peptide Name | Mag TiO2-GSH |
| Peptide sequence | GSH |
| N-Terminal Modification | Mag TiO2 |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | tripeptide |
| Conjugate partner | None |
| Technique | mass spectrometry |
| Temperature | Room temperature |
| Incubation Time | 20 h |
| Year | 2019 |
| Self assembly | No |
| Type of Self assembly | nanocomposites |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanostructure | |
| NA | |
| None | |
| NCC(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC1=CN=C-N1)C(=O)O | |
| Primary information | |
| SAPdb ID | 1767, |
| PMID | 30978284 |
| Peptide Name | γ-Glu-Cys-Gly |
| Peptide sequence | GSH |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | tripeptide |
| Conjugate partner | None |
| Technique | Infrared spectroscopy and Polarization-selective 2DIR spectroscopy |
| Solvent | D2O |
| Conc | 0.1 M |
| Temperature | 5.5 |
| Year | 2019 |
| Self assembly | Yes |
| Type of Self assembly | nanoparticles |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanoparticle | |
| NA | |
| None | |
| NCC(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC1=CN=C-N1)C(=O)O | |
| Primary information | |
| SAPdb ID | 1773, |
| PMID | 31080538 |
| Peptide Name | glutathione |
| Peptide sequence | GSH |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | tripeptide |
| Conjugate partner | None |
| Technique | Microwave-Accelerated Evaporative Crystallization (MA-MAEC), XRD, FTIR |
| Solvent | DMF, DMSO, ethanol, water, PBS, sodium acetate, and sodium pHospHate dibasic |
| Conc | 300-500 mg/mL |
| Temperature | 7.4, 4.6, 9.1 |
| Temperature | Room temperature |
| Year | 2017 |
| Self assembly | Yes |
| Type of Self assembly | nanoparticles |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanoparticle | |
| NA | |
| None | |
| NCC(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC1=CN=C-N1)C(=O)O | |
| Primary information | |
| SAPdb ID | 1774, |
| PMID | 31139800 |
| Peptide Name | magHN/Au-GSH |
| Peptide sequence | GSH |
| N-Terminal Modification | magHN/Au |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | tripeptide |
| Conjugate partner | None |
| Technique | TEM, EDS, FTIR, XRD |
| Temperature | 50 °C |
| Incubation Time | 10 h |
| Year | 2019 |
| Self assembly | Yes |
| Type of Self assembly | nanofiber |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Nanofiber | |
| NA | |
| None | |
| NCC(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC1=CN=C-N1)C(=O)O | |
| Primary information | |
| SAPdb ID | 1780, |
| PMID | 31267341 |
| Peptide Name | Glutathione |
| Peptide sequence | GSH |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | tripeptide |
| Conjugate partner | None |
| Year | 2019 |
| Self assembly | Yes |
| Type of Self assembly | nanoparticles |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanoparticle | |
| 10 nm | |
| None | |
| NCC(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC1=CN=C-N1)C(=O)O | |