Welcome to Entry Card of Peptide
Details of SAPdb ID 1688 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1688 | |
| PMID | 29972201 | |
| Year | 2018 | |
| Name | Glutathione | |
| Sequence | GSH | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 3 | |
| Peptide/Conjugate/Mixture | tripeptide | |
| Conjugate Partner | None | |
| Technique | High-resolution transmission electron microscopy (HR-TEM) | |
| Solvent | aqueous soltuion of NaDC | |
| Method | NA | |
| Concentration | 40 mM | |
| pH | NA | |
| Temperature | Room temperature | |
| Incubation Period | 24 hours | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | nanofibers | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | NCC(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC1=CN=C-N1)C(=O)O | |