Details of SAPdb ID 1767 |
Primary information | ||
---|---|---|
SAPdb_ID | 1767 | |
PMID | 30978284 | |
Year | 2019 | |
Name | γ-Glu-Cys-Gly | |
Sequence | GSH | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 3 | |
Peptide/Conjugate/Mixture | tripeptide | |
Conjugate Partner | None | |
Technique | Infrared spectroscopy and Polarization-selective 2DIR spectroscopy | |
Solvent | D2O | |
Method | NA | |
Concentration | 0.1 M | |
pH | 5.5 | |
Temperature | NA | |
Incubation Period | NA | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | nanoparticles | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | NCC(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC1=CN=C-N1)C(=O)O |