Welcome to Entry Card of Peptide
Details of SAPdb ID 1773 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1773 | |
| PMID | 31080538 | |
| Year | 2017 | |
| Name | glutathione | |
| Sequence | GSH | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 3 | |
| Peptide/Conjugate/Mixture | tripeptide | |
| Conjugate Partner | None | |
| Technique | Microwave-Accelerated Evaporative Crystallization (MA-MAEC), XRD, FTIR | |
| Solvent | DMF, DMSO, ethanol, water, PBS, sodium acetate, and sodium pHospHate dibasic | |
| Method | NA | |
| Concentration | 300-500 mg/mL | |
| pH | 7.4, 4.6, 9.1 | |
| Temperature | Room temperature | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | nanoparticles | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | NCC(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC1=CN=C-N1)C(=O)O | |