Welcome to Entry Card of Peptide
Details of SAPdb ID 1774 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1774 | |
| PMID | 31139800 | |
| Year | 2019 | |
| Name | magHN/Au-GSH | |
| Sequence | GSH | |
| N-Terminal Modification | magHN/Au | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 3 | |
| Peptide/Conjugate/Mixture | tripeptide | |
| Conjugate Partner | None | |
| Technique | TEM, EDS, FTIR, XRD | |
| Solvent | NA | |
| Method | NA | |
| Concentration | NA | |
| pH | NA | |
| Temperature | 50 °C | |
| Incubation Period | 10 h | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | nanofiber | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | Stable | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | NCC(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC1=CN=C-N1)C(=O)O | |