Welcome to Entry Card of Peptide
Details of SAPdb ID 1689 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1689 | |
| PMID | 30021438 | |
| Year | 2018 | |
| Name | Glutathione | |
| Sequence | GSH | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 3 | |
| Peptide/Conjugate/Mixture | conjugated | |
| Conjugate Partner | TetrapHenylethylene (TPE) | |
| Technique | Transmission Electron Microscopy (TEM) | |
| Solvent | FMOC-Gly-Wang resin | |
| Method | structure of γ-GSH, tripeptides were designed for the construction of Hg2+-responsive supermolecular assemblies | |
| Concentration | 50% ACN, 25% of 0.1% TFA, and 25% | |
| pH | NA | |
| Temperature | NA | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | nanofibers | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | NA | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | NCC(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC1=CN=C-N1)C(=O)O | |