| ID | 1648 | |
| PMID | 8321834 | |
| Year | 1992 | |
| Sequence | CYFQNCPRG | |
| Name | [Arg 8 ]vasopressin | |
| Length | 9 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | Synthetic | |
| Nature of Peptide/Cargo | Not mentioned | |
| Mechanism | Not mentioned | |
| Cargo Sequence/Structure | No cargo | |
| Name of cargo | Not applicable | |
| Assay | permeability coefficient for transdermal iontophoretic transport of peptide/ protein drugs from p-HEMA was measured. | |
| Enhancer | PH 3.6 | |
| Properties of enhancer | Not mentioned | |
| Concentration | 0.65mM | |
| Incubation time | 36 hrs | |
| Tissue permeability (value with units) | 10.6 (cm/sec) * 10 8 | |
| Tissue Sample | skin of hairless rat | |
| Ex vivo/In vivo/In vitro | in vitro | |
| STRUCTURE |
| |
| SMILES | N[C@@H](CS)C(=O)N[C@@H](Cc1ccc(O)cc1)C (=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H] (CCC(=O)N)C(=O)N[C@@H](CC(=O)N)C(=O) N[C@@H](CS)C(=O)N1CCC[C@H] 1C(=O)N[C@@H](CCCNC(=[NH2])N)C(=O)NCC=O | |