Details of TopicalPdb ID 1633
ID | 1633 | |
PMID | 2664126 | |
Year | 1989 | |
Sequence | CYFQNCPRG | |
Name | Arginine-Vasopressin | |
Length | 9 | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Linear/ Cyclic | Linear | |
Chirality | L | |
Chemical Modification | None | |
Origin of Peptide | Synthetic | |
Nature of Peptide/Cargo | nonapeptide hormone | |
Mechanism | Not mentioned | |
Cargo Sequence/Structure | No cargo | |
Name of cargo | Not applicable | |
Assay | Iontophoresis permetaion studies | |
Enhancer | citrate phosphate buffer, at pH 5 or pH 7. (~0.25 M ionic strength) | |
Properties of enhancer | Not mentioned | |
Concentration | 0.08 mM | |
Incubation time | The amount of AVP permeating through the skin was monitored during the current application and then for another 5 hrs after the termination of | |
Tissue permeability (value with units) | 0.509(+-0.056)nmol/cm2h+-S.D | |
Tissue Sample | abdominal region of hairless mouse | |
Ex vivo/In vivo/In vitro | in vitro | |
STRUCTURE |
| |
SMILES | N[C@@H](CS)C(=O)N[C@@H](Cc1ccc(O)cc1)C (=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H] (CCC(=O)N)C(=O)N[C@@H](CC(=O)N)C(=O) N[C@@H](CS)C(=O)N1CCC[C@H] 1C(=O)N[C@@H](CCCNC(=[NH2])N)C(=O)NCC=O |