| ID | 1633 | |
| PMID | 2664126 | |
| Year | 1989 | |
| Sequence | CYFQNCPRG | |
| Name | Arginine-Vasopressin | |
| Length | 9 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | Synthetic | |
| Nature of Peptide/Cargo | nonapeptide hormone | |
| Mechanism | Not mentioned | |
| Cargo Sequence/Structure | No cargo | |
| Name of cargo | Not applicable | |
| Assay | Iontophoresis permetaion studies | |
| Enhancer | citrate phosphate buffer, at pH 5 or pH 7. (~0.25 M ionic strength) | |
| Properties of enhancer | Not mentioned | |
| Concentration | 0.08 mM | |
| Incubation time | The amount of AVP permeating through the skin was monitored during the current application and then for another 5 hrs after the termination of | |
| Tissue permeability (value with units) | 0.509(+-0.056)nmol/cm2h+-S.D | |
| Tissue Sample | abdominal region of hairless mouse | |
| Ex vivo/In vivo/In vitro | in vitro | |
| STRUCTURE |
| |
| SMILES | N[C@@H](CS)C(=O)N[C@@H](Cc1ccc(O)cc1)C (=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H] (CCC(=O)N)C(=O)N[C@@H](CC(=O)N)C(=O) N[C@@H](CS)C(=O)N1CCC[C@H] 1C(=O)N[C@@H](CCCNC(=[NH2])N)C(=O)NCC=O | |