| PRIMARY INFORMATION |
|---|
| ID | 1613 |
| PMID | 21973177 |
| Year | 2011 |
| Sequence | DR-NorLeu-TIHP |
| Name | NorLeu3 -A(1-7) |
| Length | 7 |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Linear/ Cyclic | Linear |
| Chirality | L |
| Chemical Modification | NorLeu=Norleucine |
| Origin of Peptide | Synthetic |
| Nature of Peptide/Cargo | The peptide accelerates and normalizes the healing of dermal injuries in multiple animal models |
| Mechanism | Accelerates dermal re-epithelialization at the wound site |
| Cargo Sequence/Structure | None |
Name of cargo
| Not applicable |
| Assay | Ulcers were seen to have a healing effect. |
| Enhancer | None |
| Properties of enhancer | Not applicable |
| Concentration | 0.03% dose |
| Incubation time | 18 days |
| Tissue permeability (value with units) | NorLeu3 -A(1-7) completely healed approximately 60% of the wounds and reduced total wound area by greater than 80% |
| Tissue Sample | Rat skin |
| Ex vivo/In vivo/In vitro | in vitro |
| SECONDARY INFORMATION |
|---|
| STRUCTURE | |
| SMILES | N[C@@H](CC(=O)O)C(=O)N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H](CCCC)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](Cc1nc[nH]c1)C(=O)N1CCC[C@H]1C=O |
