| PRIMARY INFORMATION |
|---|
| ID | 1612 |
| PMID | 25384620 |
| Year | 2014 |
| Sequence | GHK-Cu |
| Name | Copper carrier peptide |
| Length | 3 |
| N-Terminal Modification | Free |
| C-Terminal Modification | Copper attached |
| Linear/ Cyclic | Linear |
| Chirality | L |
| Chemical Modification | None |
| Origin of Peptide | Not mentioned |
| Nature of Peptide/Cargo | Wound healing and anti-aging cosmetic agent |
| Mechanism | Affects after being transferred by the means of niosomes. |
| Cargo Sequence/Structure | Cu |
Name of cargo
| Copper |
| Assay | Not mentioned |
| Enhancer | Niosomes placed in stability chamber at 40degree Celsius, 75% RH for 4 weeks before analysis. |
| Properties of enhancer | Non-ionic surfactant based vesicle |
| Concentration | 75mg/ml |
| Incubation time | 4 weeks |
| Tissue permeability (value with units) | Topical application of GHK-Cu on 71 volunteers showed improvement in fine lines , visoelstic properties, thickness and density of the skin with no irritation |
| Tissue Sample | Human skin |
| Ex vivo/In vivo/In vitro | in vitro |
| SECONDARY INFORMATION |
|---|
| STRUCTURE | |
| SMILES | NCC(=O)N[C@@H](Cc1nc[nH]c1)C
(=O)N[C@@H](CCCC[NH3])C=O |
