Details of TopicalPdb ID 1611
| ID | 1611 | |
| PMID | 18236243 | |
| Year | 2007 | |
| Sequence | Mn-GHK | |
| Name | Manganese peptide | |
| Length | 3 | |
| N-Terminal Modification | Manganese | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | Synthetic | |
| Nature of Peptide/Cargo | Not mentioned | |
| Mechanism | Not mentioned | |
| Cargo Sequence/Structure | No cargo | |
| Name of cargo | Not applicable | |
| Assay | Overall improvement in skin texture was noticed,reduction of superficial fine lines and wrinkles were less. | |
| Enhancer | No use of topical and systemic retinoids, alpha and beta hydroxy acids, and other topical skin care products. And, no director exposure to sun. | |
| Properties of enhancer | Not mentioned | |
| Concentration | Used as a cream, topically applied on skin | |
| Incubation time | 12 weeks | |
| Tissue permeability (value with units) | Pigmentation was seen to improve in people after the use of manganese peptide containing cream. | |
| Tissue Sample | Human facial skin | |
| Ex vivo/In vivo/In vitro | in vitro | |
| STRUCTURE |
| |
| SMILES | NCC(=O)N[C@@H](Cc1nc[nH]c1)C (=O)N[C@@H](CCCC[NH3])C=O | |