| PRIMARY INFORMATION |
|---|
| ID | 1591 |
| PMID | 25786877 |
| Year | 2013 |
| Sequence | AAVP |
| Name | Alanine–alanine–proline–valin |
| Length | 4 |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Linear/ Cyclic | Linear |
| Chirality | L |
| Chemical Modification | None |
| Origin of Peptide | Synthetic |
| Nature of Peptide/Cargo | It fits the P-P1 subsite of elastase and inhibits human neutrophil elastase |
| Mechanism | Not mentioned |
| Cargo Sequence/Structure | None |
Name of cargo
| Not applicable |
| Assay | electroosmotic volume flux was observed to study peptide penetration |
| Enhancer | The donor solution pH was maintained at physiological pH 7.4 or at pH levels 6.0, 5.5, 5.0 and 3 using 0.1 or 0.01 M sodium hydroxide (NaOH) and/or 0.1 or 0.01 M hydrochloric acid (Hcl) solutions. |
| Properties of enhancer | Not mentioned |
| Concentration | 1-10 mg/ml |
| Incubation time | Not mentioned |
| Tissue permeability (value with units) | Skin permeability of peptide increased 30 times more than passive permeation by ionophoresis |
| Tissue Sample | Human epidermal membrane |
| Ex vivo/In vivo/In vitro | in vitro |
| SECONDARY INFORMATION |
|---|
| STRUCTURE | |
| SMILES | N[C@@H](C)C(=O)N[C@@H](C)C(=O)N
[C@@H](C(C)C)C(=O)N1CCC[C@H]1C=O |
