| ID | 1542 | |
| PMID | 22386653 | |
| Year | 2012 | |
| Sequence | HLTFPLD | |
| Name | P5-1 (381–387 residue of full-length PEDF protein) | |
| Length | 7 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | PEDF derived peptide | |
| Nature of Peptide/Cargo | Not mentioned | |
| Mechanism | PEDF derived peptide | |
| Cargo Sequence/Structure | None | |
| Name of cargo | Not applicable | |
| Assay | VEGF and 8-OHdG Immunostaining, Measurement of corneal neo-vascularization via avidin-biotin-alkaline phosphatase kit and statistical analysis | |
| Enhancer | None | |
| Properties of enhancer | Not applicable | |
| Concentration | 100µM PEDF peptide thrice a day for 7 days | |
| Incubation time | 7 Days | |
| Tissue permeability (value with units) | Neo-vascularized area=82% of PBS on day 7(Control=4% of PBS); Oxidative stress generation, 8-OHdG level=80% of PBS (Control=50% of PBS); VEGF expression, VEGF level=73% of PBS (Control=40% of PBS) | |
| Tissue Sample | Seven week-old male Spraque–Dawley rat's right eye was used as test and left eye considered as control (PBS) | |
| Ex vivo/In vivo/In vitro | in vivo | |
| STRUCTURE |
| |
| SMILES | N[C@@H](Cc1nc[nH]c1)C(=O)N[C@@H](CC(C)C)C(=O) N[C@@H]([C@@H](C)O)C(=O)N[C@@H](Cc1ccccc1)C (=O)N1CCC[C@H]1C(=O)N[C@@H](CC(C)C)C(=O)N [C@@H](CC(=O)O)C=O | |